C8H4N2OS3 — CID 14183492
(2-oxo-4-thiophen-2-yl-3H-1,3-thiazol-5-yl) thiocyanate (PubChem CID 14183492) has the molecular formula C8H4N2OS3 and a molecular weight of 240.33 g/mol. Its IUPAC name is (2-oxo-4-thiophen-2-yl-3H-1,3-thiazol-5-yl) thiocyanate.
| Compound Name | (2-oxo-4-thiophen-2-yl-3H-1,3-thiazol-5-yl) thiocyanate |
|---|---|
| PubChem CID | 14183492 |
| Molecular Formula | C8H4N2OS3 |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | (2-oxo-4-thiophen-2-yl-3H-1,3-thiazol-5-yl) thiocyanate |
| SMILES | N#CSc1sc(=O)[nH]c1-c1cccs1 |
| InChI | InChI=1S/C8H4N2OS3/c9-4-13-7-6(10-8(11)14-7)5-2-1-3-12-5/h1-3H,(H,10,11) |
| InChIKey | ZBSSLXRNNHGJKY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|