C8H5NOS3 — CID 760085
2-sulfanylidene-6-thiophen-2-yl-1,3-thiazin-4-one (PubChem CID 760085) has the molecular formula C8H5NOS3 and a molecular weight of 227.34 g/mol. Its IUPAC name is 2-sulfanylidene-6-thiophen-2-yl-1,3-thiazin-4-one.
| Compound Name | 2-sulfanylidene-6-thiophen-2-yl-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 760085 |
| Molecular Formula | C8H5NOS3 |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 226.95 |
| IUPAC Name | 2-sulfanylidene-6-thiophen-2-yl-1,3-thiazin-4-one |
| SMILES | O=c1cc(-c2cccs2)sc(=S)[nH]1 |
| InChI | InChI=1S/C8H5NOS3/c10-7-4-6(13-8(11)9-7)5-2-1-3-12-5/h1-4H,(H,9,10,11) |
| InChIKey | YJTFIMIGVVQHES-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ester_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|