C14H18N6O2 — CID 835463
[(3-nitrophenyl)-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazine (PubChem CID 835463) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is [(3-nitrophenyl)-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazine.
| Compound Name | [(3-nitrophenyl)-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazine |
|---|---|
| PubChem CID | 835463 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(3-nitrophenyl)-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazine |
| SMILES | NN=C(c1cccc([N+](=O)[O-])c1)C12CN3CN(CN(C3)C1)C2 |
| InChI | InChI=1S/C14H18N6O2/c15-16-13(11-2-1-3-12(4-11)20(21)22)14-5-17-8-18(6-14)10-19(7-14)9-17/h1-4H,5-10,15H2 |
| InChIKey | IJOBMMQPVNQQHR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|