C21H21BrN6O2 — CID 6877523
(E)-N-[(E)-(2-bromophenyl)methylideneamino]-1-(3-nitrophenyl)-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine (PubChem CID 6877523) has the molecular formula C21H21BrN6O2 and a molecular weight of 469.34 g/mol. Its IUPAC name is (E)-N-[(E)-(2-bromophenyl)methylideneamino]-1-(3-nitrophenyl)-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine.
| Compound Name | (E)-N-[(E)-(2-bromophenyl)methylideneamino]-1-(3-nitrophenyl)-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
|---|---|
| PubChem CID | 6877523 |
| Molecular Formula | C21H21BrN6O2 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | (E)-N-[(E)-(2-bromophenyl)methylideneamino]-1-(3-nitrophenyl)-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(/C(=N/N=C/c2ccccc2Br)C23CN4CN(CN(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H21BrN6O2/c22-19-7-2-1-4-17(19)9-23-24-20(16-5-3-6-18(8-16)28(29)30)21-10-25-13-26(11-21)15-27(12-21)14-25/h1-9H,10-15H2/b23-9+,24-20- |
| InChIKey | AOOMTTVLHVVELJ-LNYFBRRSSA-N |
| XLogP | 2.99 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|