C22H25N5O2 — CID 135851468
2-methoxy-6-[(E)-[(E)-[phenyl(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazinylidene]methyl]phenol (PubChem CID 135851468) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-methoxy-6-[(E)-[(E)-[phenyl(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-6-[(E)-[(E)-[phenyl(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135851468 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-methoxy-6-[(E)-[(E)-[phenyl(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methylidene]hydrazinylidene]methyl]phenol |
| SMILES | COc1cccc(/C=N/N=C(\c2ccccc2)C23CN4CN(CN(C4)C2)C3)c1O |
| InChI | InChI=1S/C22H25N5O2/c1-29-19-9-5-8-18(20(19)28)10-23-24-21(17-6-3-2-4-7-17)22-11-25-14-26(12-22)16-27(13-22)15-25/h2-10,28H,11-16H2,1H3/b23-10+,24-21+ |
| InChIKey | VZFNGYDENLSAIB-HKPXGLIESA-N |
| XLogP | 2.03 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|