C8H10N2O4 — CID 83617873
3-[[2-(1,3-oxazol-4-yl)acetyl]amino]propanoic acid (PubChem CID 83617873) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 3-[[2-(1,3-oxazol-4-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(1,3-oxazol-4-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 83617873 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-[[2-(1,3-oxazol-4-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Cc1cocn1 |
| InChI | InChI=1S/C8H10N2O4/c11-7(9-2-1-8(12)13)3-6-4-14-5-10-6/h4-5H,1-3H2,(H,9,11)(H,12,13) |
| InChIKey | NKRXBKFWICHIIV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |