C10H10N2O3 — CID 110686247
N-(furan-2-ylmethyl)-2-(1,3-oxazol-4-yl)acetamide (PubChem CID 110686247) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(1,3-oxazol-4-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 110686247 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(1,3-oxazol-4-yl)acetamide |
| SMILES | O=C(Cc1cocn1)NCc1ccco1 |
| InChI | InChI=1S/C10H10N2O3/c13-10(4-8-6-14-7-12-8)11-5-9-2-1-3-15-9/h1-3,6-7H,4-5H2,(H,11,13) |
| InChIKey | COPITNSLCVOBHY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |