About 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid
3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid (PubChem CID 110836055) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid.
Analyze 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid?
The IUPAC name of 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid (CID 110836055) is 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid.
What is the SMILES notation for 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid?
The canonical SMILES for 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid is Cc1nc(CC(=O)NCCC(=O)O)co1.
What is the InChIKey of 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid?
The InChIKey is IWXPTBHVXNHEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-6-11-7(5-15-6)4-8(12)10-3-2-9(13)14/h5H,2-4H2,1H3,(H,10,12)(H,13,14).
What are the key properties of 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid?
3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid has a molecular weight of 212.20 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2-methyl-1,3-oxazol-4-yl)acetyl]amino]propanoic acid is sourced from PubChem (CID 110836055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).