4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid

C9H12N2O4 — CID 110836026

IUPAC4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCNC(=O)Cc1cocn1
InChIInChI=1S/C9H12N2O4/c12-8(4-7-5-15-6-11-7)10-3-1-2-9(13)14/h5-6H,1-4H2,(H,10,12)(H,13,14)
InChIKeyZLAKNMKVWPEWNC-UHFFFAOYSA-N
MW212.20 g/mol
LogP0.20
Rot. Bonds6

About 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid

4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid (PubChem CID 110836026) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid.

Molecular Properties

Compound Name4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid
PubChem CID110836026
Molecular FormulaC9H12N2O4
Molecular Weight212.20 g/mol
Exact Mass212.08
IUPAC Name4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCNC(=O)Cc1cocn1
InChIInChI=1S/C9H12N2O4/c12-8(4-7-5-15-6-11-7)10-3-1-2-9(13)14/h5-6H,1-4H2,(H,10,12)(H,13,14)
InChIKeyZLAKNMKVWPEWNC-UHFFFAOYSA-N
XLogP0.20
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.20
LogP ≤ 50.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid?
The IUPAC name of 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid (CID 110836026) is 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid.
What is the SMILES notation for 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid?
The canonical SMILES for 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid is O=C(O)CCCNC(=O)Cc1cocn1.
What is the InChIKey of 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid?
The InChIKey is ZLAKNMKVWPEWNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c12-8(4-7-5-15-6-11-7)10-3-1-2-9(13)14/h5-6H,1-4H2,(H,10,12)(H,13,14).
What are the key properties of 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid?
4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid has a molecular weight of 212.20 g/mol, XLogP of 0.20, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(1,3-oxazol-4-yl)acetyl]amino]butanoic acid is sourced from PubChem (CID 110836026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).