C8H13N3O2 — CID 83618116
4-(methylamino)-N-(1,3-oxazol-5-yl)butanamide (PubChem CID 83618116) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-(methylamino)-N-(1,3-oxazol-5-yl)butanamide.
| Compound Name | 4-(methylamino)-N-(1,3-oxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 83618116 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-(methylamino)-N-(1,3-oxazol-5-yl)butanamide |
| SMILES | CNCCCC(=O)Nc1cnco1 |
| InChI | InChI=1S/C8H13N3O2/c1-9-4-2-3-7(12)11-8-5-10-6-13-8/h5-6,9H,2-4H2,1H3,(H,11,12) |
| InChIKey | XPUVZUYXHFLGJC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|