3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid

C13H13NO2 — CID 83640199

IUPAC3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid
SMILESCc1[nH]c(C(=O)O)c(C)c1-c1ccccc1
InChIInChI=1S/C13H13NO2/c1-8-11(10-6-4-3-5-7-10)9(2)14-12(8)13(15)16/h3-7,14H,1-2H3,(H,15,16)
InChIKeyFIAHGHIBJWMVQW-UHFFFAOYSA-N
MW215.25 g/mol
LogP3.00
Rot. Bonds2

About 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid

3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid (PubChem CID 83640199) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid.

Molecular Properties

Compound Name3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid
PubChem CID83640199
Molecular FormulaC13H13NO2
Molecular Weight215.25 g/mol
Exact Mass215.09
IUPAC Name3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid
SMILESCc1[nH]c(C(=O)O)c(C)c1-c1ccccc1
InChIInChI=1S/C13H13NO2/c1-8-11(10-6-4-3-5-7-10)9(2)14-12(8)13(15)16/h3-7,14H,1-2H3,(H,15,16)
InChIKeyFIAHGHIBJWMVQW-UHFFFAOYSA-N
XLogP3.00
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 53.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid?
The IUPAC name of 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid (CID 83640199) is 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid?
The canonical SMILES for 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid is Cc1[nH]c(C(=O)O)c(C)c1-c1ccccc1.
What is the InChIKey of 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid?
The InChIKey is FIAHGHIBJWMVQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c1-8-11(10-6-4-3-5-7-10)9(2)14-12(8)13(15)16/h3-7,14H,1-2H3,(H,15,16).
What are the key properties of 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid?
3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid has a molecular weight of 215.25 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 83640199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).