About 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid
3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid (PubChem CID 83668316) has the molecular formula C8H8O5
and a molecular weight of 184.15 g/mol. Its IUPAC name is 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid.
Analyze 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid?
The IUPAC name of 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid (CID 83668316) is 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid.
What is the SMILES notation for 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid?
The canonical SMILES for 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid is O=C(O)c1occ2c1OCCCO2.
What is the InChIKey of 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid?
The InChIKey is VIQVKGRKMYQITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O5/c9-8(10)7-6-5(4-13-7)11-2-1-3-12-6/h4H,1-3H2,(H,9,10).
What are the key properties of 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid?
3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid has a molecular weight of 184.15 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-furo[3,4-b][1,4]dioxepine-6-carboxylic acid is sourced from PubChem (CID 83668316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).