About 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile
1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile (PubChem CID 83752837) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile.
Analyze 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile?
The IUPAC name of 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile (CID 83752837) is 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile.
What is the SMILES notation for 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile?
The canonical SMILES for 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile is Cc1cccc2c1N(C)CC(C#N)C2.
What is the InChIKey of 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile?
The InChIKey is YSUVSAGJPUJMBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-9-4-3-5-11-6-10(7-13)8-14(2)12(9)11/h3-5,10H,6,8H2,1-2H3.
What are the key properties of 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile?
1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile has a molecular weight of 186.26 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethyl-3,4-dihydro-2H-quinoline-3-carbonitrile is sourced from PubChem (CID 83752837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).