C11H10N2O — CID 83817553
2-isocyanato-1,7-dimethylindole (PubChem CID 83817553) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-isocyanato-1,7-dimethylindole.
| Compound Name | 2-isocyanato-1,7-dimethylindole |
|---|---|
| PubChem CID | 83817553 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-isocyanato-1,7-dimethylindole |
| SMILES | Cc1cccc2cc(N=C=O)n(C)c12 |
| InChI | InChI=1S/C11H10N2O/c1-8-4-3-5-9-6-10(12-7-14)13(2)11(8)9/h3-6H,1-2H3 |
| InChIKey | FAEZPCZMQQWRGQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|