C8H12N2O2S — CID 83819254
3-(ethylamino)-3-(1,3-thiazol-5-yl)propanoic acid (PubChem CID 83819254) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-(ethylamino)-3-(1,3-thiazol-5-yl)propanoic acid.
| Compound Name | 3-(ethylamino)-3-(1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 83819254 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(ethylamino)-3-(1,3-thiazol-5-yl)propanoic acid |
| SMILES | CCNC(CC(=O)O)c1cncs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-2-10-6(3-8(11)12)7-4-9-5-13-7/h4-6,10H,2-3H2,1H3,(H,11,12) |
| InChIKey | LQBBCMIIKLLHOS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |