C8H11F3O2S — CID 83823682
3,3,3-trifluoro-2-(thian-4-yl)propanoic acid (PubChem CID 83823682) has the molecular formula C8H11F3O2S and a molecular weight of 228.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(thian-4-yl)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-(thian-4-yl)propanoic acid |
|---|---|
| PubChem CID | 83823682 |
| Molecular Formula | C8H11F3O2S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 3,3,3-trifluoro-2-(thian-4-yl)propanoic acid |
| SMILES | O=C(O)C(C1CCSCC1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2S/c9-8(10,11)6(7(12)13)5-1-3-14-4-2-5/h5-6H,1-4H2,(H,12,13) |
| InChIKey | QDEQKZKDRHWCQX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |