C9H9N3O — CID 83827412
2-amino-1-imidazo[1,5-a]pyridin-7-ylethanone (PubChem CID 83827412) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 2-amino-1-imidazo[1,5-a]pyridin-7-ylethanone.
| Compound Name | 2-amino-1-imidazo[1,5-a]pyridin-7-ylethanone |
|---|---|
| PubChem CID | 83827412 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 2-amino-1-imidazo[1,5-a]pyridin-7-ylethanone |
| SMILES | NCC(=O)c1ccn2cncc2c1 |
| InChI | InChI=1S/C9H9N3O/c10-4-9(13)7-1-2-12-6-11-5-8(12)3-7/h1-3,5-6H,4,10H2 |
| InChIKey | UVTMYFQRAYGAJU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |