C8H9N5O2 — CID 83833639
2-ethyl-3-nitroimidazo[1,2-a]pyrimidin-6-amine (PubChem CID 83833639) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-ethyl-3-nitroimidazo[1,2-a]pyrimidin-6-amine.
| Compound Name | 2-ethyl-3-nitroimidazo[1,2-a]pyrimidin-6-amine |
|---|---|
| PubChem CID | 83833639 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-ethyl-3-nitroimidazo[1,2-a]pyrimidin-6-amine |
| SMILES | CCc1nc2ncc(N)cn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N5O2/c1-2-6-7(13(14)15)12-4-5(9)3-10-8(12)11-6/h3-4H,2,9H2,1H3 |
| InChIKey | CLVZBZHOXBCTNW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|