C11H13N3O2 — CID 83837004
3-(5,7-dimethylimidazo[1,2-a]pyrimidin-3-yl)propanoic acid (PubChem CID 83837004) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(5,7-dimethylimidazo[1,2-a]pyrimidin-3-yl)propanoic acid.
| Compound Name | 3-(5,7-dimethylimidazo[1,2-a]pyrimidin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 83837004 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(5,7-dimethylimidazo[1,2-a]pyrimidin-3-yl)propanoic acid |
| SMILES | Cc1cc(C)n2c(CCC(=O)O)cnc2n1 |
| InChI | InChI=1S/C11H13N3O2/c1-7-5-8(2)14-9(3-4-10(15)16)6-12-11(14)13-7/h5-6H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | URFCOTFRVQOYLE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |