C8H11BrN2O — CID 83840662
2-(4-bromo-1,3-dimethylpyrazol-5-yl)propanal (PubChem CID 83840662) has the molecular formula C8H11BrN2O and a molecular weight of 231.09 g/mol. Its IUPAC name is 2-(4-bromo-1,3-dimethylpyrazol-5-yl)propanal.
| Compound Name | 2-(4-bromo-1,3-dimethylpyrazol-5-yl)propanal |
|---|---|
| PubChem CID | 83840662 |
| Molecular Formula | C8H11BrN2O |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 2-(4-bromo-1,3-dimethylpyrazol-5-yl)propanal |
| SMILES | Cc1nn(C)c(C(C)C=O)c1Br |
| InChI | InChI=1S/C8H11BrN2O/c1-5(4-12)8-7(9)6(2)10-11(8)3/h4-5H,1-3H3 |
| InChIKey | RFZUGRIECBLXDL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|