C11H10ClNOS — CID 83843043
7-chloro-4-(isocyanatomethyl)-3,4-dihydro-2H-thiochromene (PubChem CID 83843043) has the molecular formula C11H10ClNOS and a molecular weight of 239.73 g/mol. Its IUPAC name is 7-chloro-4-(isocyanatomethyl)-3,4-dihydro-2H-thiochromene.
| Compound Name | 7-chloro-4-(isocyanatomethyl)-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 83843043 |
| Molecular Formula | C11H10ClNOS |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 7-chloro-4-(isocyanatomethyl)-3,4-dihydro-2H-thiochromene |
| SMILES | O=C=NCC1CCSc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H10ClNOS/c12-9-1-2-10-8(6-13-7-14)3-4-15-11(10)5-9/h1-2,5,8H,3-4,6H2 |
| InChIKey | YEWLYTZWOFLTJQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|