C8H12N2O2 — CID 83846042
5-ethyl-1,4-dimethylimidazole-2-carboxylic acid (PubChem CID 83846042) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-ethyl-1,4-dimethylimidazole-2-carboxylic acid.
| Compound Name | 5-ethyl-1,4-dimethylimidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 83846042 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-ethyl-1,4-dimethylimidazole-2-carboxylic acid |
| SMILES | CCc1c(C)nc(C(=O)O)n1C |
| InChI | InChI=1S/C8H12N2O2/c1-4-6-5(2)9-7(8(11)12)10(6)3/h4H2,1-3H3,(H,11,12) |
| InChIKey | FBJTZQDWGBMKJX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |