C10H15NO3 — CID 83847777
4,4,5,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-c]pyrrole-1,3-dione (PubChem CID 83847777) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 4,4,5,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-c]pyrrole-1,3-dione.
| Compound Name | 4,4,5,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 83847777 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4,4,5,6-tetramethyl-6,6a-dihydro-3aH-furo[3,4-c]pyrrole-1,3-dione |
| SMILES | CC1C2C(=O)OC(=O)C2C(C)(C)N1C |
| InChI | InChI=1S/C10H15NO3/c1-5-6-7(9(13)14-8(6)12)10(2,3)11(5)4/h5-7H,1-4H3 |
| InChIKey | AWWHSDAGYIGDIA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|