C10H14N2O6 — CID 161163194
(4S)-3,4-dimethyl-1,3-oxazolidine-2,5-dione;(4R)-3,4-dimethyl-1,3-oxazolidine-2,5-dione (PubChem CID 161163194) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is (4S)-3,4-dimethyl-1,3-oxazolidine-2,5-dione;(4R)-3,4-dimethyl-1,3-oxazolidine-2,5-dione.
| Compound Name | (4S)-3,4-dimethyl-1,3-oxazolidine-2,5-dione;(4R)-3,4-dimethyl-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 161163194 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (4S)-3,4-dimethyl-1,3-oxazolidine-2,5-dione;(4R)-3,4-dimethyl-1,3-oxazolidine-2,5-dione |
| SMILES | C[C@@H]1C(=O)OC(=O)N1C.C[C@H]1C(=O)OC(=O)N1C |
| InChI | InChI=1S/2C5H7NO3/c2*1-3-4(7)9-5(8)6(3)2/h2*3H,1-2H3/t2*3-/m10/s1 |
| InChIKey | UQEPFLASEIMMMB-OASOTCBPSA-N |
| XLogP | -0.03 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|