C8H9NO2 — CID 173056970
3-methyl-3a,4-dihydro-1,3-benzoxazol-2-one (PubChem CID 173056970) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-methyl-3a,4-dihydro-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-3a,4-dihydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 173056970 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-methyl-3a,4-dihydro-1,3-benzoxazol-2-one |
| SMILES | CN1C(=O)OC2=CC=CCC21 |
| InChI | InChI=1S/C8H9NO2/c1-9-6-4-2-3-5-7(6)11-8(9)10/h2-3,5-6H,4H2,1H3 |
| InChIKey | BVTRRRDZQBGHFN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |