C15H16N2O — CID 69497384
5-amino-7-methyl-4a,7-dihydro-4H-benzo[d][1]benzazepin-6-one (PubChem CID 69497384) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-amino-7-methyl-4a,7-dihydro-4H-benzo[d][1]benzazepin-6-one.
| Compound Name | 5-amino-7-methyl-4a,7-dihydro-4H-benzo[d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 69497384 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-amino-7-methyl-4a,7-dihydro-4H-benzo[d][1]benzazepin-6-one |
| SMILES | CC1C(=O)N(N)C2CC=CC=C2c2ccccc21 |
| InChI | InChI=1S/C15H16N2O/c1-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)17(16)15(10)18/h2-8,10,14H,9,16H2,1H3 |
| InChIKey | VEAMNWGTNQOOBJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|