C16H19N — CID 90847264
8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;ethane (PubChem CID 90847264) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;ethane.
| Compound Name | 8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;ethane |
|---|---|
| PubChem CID | 90847264 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;ethane |
| SMILES | C1=CCC2C(=C1)c1cccc3c1N2CC3.CC |
| InChI | InChI=1S/C14H13N.C2H6/c1-2-7-13-11(5-1)12-6-3-4-10-8-9-15(13)14(10)12;1-2/h1-6,13H,7-9H2;1-2H3 |
| InChIKey | BGQDTDJDFNMTSG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |