C17H25NSi — CID 157326875
8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;dimethylsilane;methane (PubChem CID 157326875) has the molecular formula C17H25NSi and a molecular weight of 271.48 g/mol. Its IUPAC name is 8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;dimethylsilane;methane.
| Compound Name | 8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;dimethylsilane;methane |
|---|---|
| PubChem CID | 157326875 |
| Molecular Formula | C17H25NSi |
| Molecular Weight | 271.48 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 8-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,11(15),12-pentaene;dimethylsilane;methane |
| SMILES | C.C1=CCC2C(=C1)c1cccc3c1N2CC3.C[SiH2]C |
| InChI | InChI=1S/C14H13N.C2H8Si.CH4/c1-2-7-13-11(5-1)12-6-3-4-10-8-9-15(13)14(10)12;1-3-2;/h1-6,13H,7-9H2;3H2,1-2H3;1H4 |
| InChIKey | BEVGQKIGSQWTLX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|