C5H10NO2P — CID 59083036
2,4-dimethyl-3-phosphanyl-1,3-oxazolidin-5-one (PubChem CID 59083036) has the molecular formula C5H10NO2P and a molecular weight of 147.11 g/mol. Its IUPAC name is 2,4-dimethyl-3-phosphanyl-1,3-oxazolidin-5-one.
| Compound Name | 2,4-dimethyl-3-phosphanyl-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 59083036 |
| Molecular Formula | C5H10NO2P |
| Molecular Weight | 147.11 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 2,4-dimethyl-3-phosphanyl-1,3-oxazolidin-5-one |
| SMILES | CC1OC(=O)C(C)N1P |
| InChI | InChI=1S/C5H10NO2P/c1-3-5(7)8-4(2)6(3)9/h3-4H,9H2,1-2H3 |
| InChIKey | ZWOQEIRPSFUMNI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.11 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|