C9H8Br2O4 — CID 124720637
(1S,2R,6R,7R,8S,9R)-8,9-dibromo-1-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 124720637) has the molecular formula C9H8Br2O4 and a molecular weight of 339.97 g/mol. Its IUPAC name is (1S,2R,6R,7R,8S,9R)-8,9-dibromo-1-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6R,7R,8S,9R)-8,9-dibromo-1-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 124720637 |
| Molecular Formula | C9H8Br2O4 |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | (1S,2R,6R,7R,8S,9R)-8,9-dibromo-1-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[C@@]12O[C@@H]([C@H](Br)[C@@H]1Br)[C@@H]1C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C9H8Br2O4/c1-9-3-2(7(12)14-8(3)13)5(15-9)4(10)6(9)11/h2-6H,1H3/t2-,3+,4+,5-,6+,9+/m1/s1 |
| InChIKey | LIWROZKJGNEHRM-YWFMFFHKSA-N |
| XLogP | 1.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|