C7H13N3O — CID 83857034
5-[(1S)-1-aminoethyl]-2,4-dimethyl-4H-pyrazol-3-one (PubChem CID 83857034) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-[(1S)-1-aminoethyl]-2,4-dimethyl-4H-pyrazol-3-one.
| Compound Name | 5-[(1S)-1-aminoethyl]-2,4-dimethyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 83857034 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 5-[(1S)-1-aminoethyl]-2,4-dimethyl-4H-pyrazol-3-one |
| SMILES | CC1C(=O)N(C)N=C1[C@H](C)N |
| InChI | InChI=1S/C7H13N3O/c1-4-6(5(2)8)9-10(3)7(4)11/h4-5H,8H2,1-3H3/t4?,5-/m0/s1 |
| InChIKey | PNCMKDNRYGQZHH-AKGZTFGVSA-N |
| XLogP | -0.20 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |