C5H12N4O — CID 13062847
2,4,6-trimethyl-1,2,4,5-tetrazinan-3-one (PubChem CID 13062847) has the molecular formula C5H12N4O and a molecular weight of 144.18 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 2,4,6-trimethyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 13062847 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 2,4,6-trimethyl-1,2,4,5-tetrazinan-3-one |
| SMILES | CC1NN(C)C(=O)N(C)N1 |
| InChI | InChI=1S/C5H12N4O/c1-4-6-8(2)5(10)9(3)7-4/h4,6-7H,1-3H3 |
| InChIKey | MXEXGQLVGJPNRV-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |