C4H7N3O — CID 163490125
4-imino-1,3-dimethyl-1,3-diazetidin-2-one (PubChem CID 163490125) has the molecular formula C4H7N3O and a molecular weight of 113.12 g/mol. Its IUPAC name is 4-imino-1,3-dimethyl-1,3-diazetidin-2-one.
| Compound Name | 4-imino-1,3-dimethyl-1,3-diazetidin-2-one |
|---|---|
| PubChem CID | 163490125 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 4-imino-1,3-dimethyl-1,3-diazetidin-2-one |
| SMILES | [H]N=C1N(C)C(=O)N1C |
| InChI | InChI=1S/C4H7N3O/c1-6-3(5)7(2)4(6)8/h5H,1-2H3 |
| InChIKey | CLWPQLBSXPNVCJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|