C7H12N4O — CID 20695120
1,3-dimethyl-4,5-bis(methylimino)imidazolidin-2-one (PubChem CID 20695120) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-bis(methylimino)imidazolidin-2-one.
| Compound Name | 1,3-dimethyl-4,5-bis(methylimino)imidazolidin-2-one |
|---|---|
| PubChem CID | 20695120 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1,3-dimethyl-4,5-bis(methylimino)imidazolidin-2-one |
| SMILES | C/N=C1C(=N/C)/N(C)C(=O)N/1C |
| InChI | InChI=1S/C7H12N4O/c1-8-5-6(9-2)11(4)7(12)10(5)3/h1-4H3/b8-5-,9-6- |
| InChIKey | OWABTQSVLHNYSX-VVRUXRSYSA-N |
| XLogP | 0.04 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|