C14H22N8O2 — CID 10759146
6-[3-(1,5-dimethyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-dimethyl-1,2,4,5-tetrazinan-3-one (PubChem CID 10759146) has the molecular formula C14H22N8O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-[3-(1,5-dimethyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-dimethyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-[3-(1,5-dimethyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-dimethyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 10759146 |
| Molecular Formula | C14H22N8O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 6-[3-(1,5-dimethyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-dimethyl-1,2,4,5-tetrazinan-3-one |
| SMILES | CN1NC(c2cccc(C3NN(C)C(=O)N(C)N3)c2)NN(C)C1=O |
| InChI | InChI=1S/C14H22N8O2/c1-19-13(23)20(2)16-11(15-19)9-6-5-7-10(8-9)12-17-21(3)14(24)22(4)18-12/h5-8,11-12,15-18H,1-4H3 |
| InChIKey | XEAHUZOXYVMCEX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |