About 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid
2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid (PubChem CID 83860435) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid.
Analyze 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid?
The IUPAC name of 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid (CID 83860435) is 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid?
The canonical SMILES for 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid is Cc1ccc2c(c1C)NCC2C(N)C(=O)O.
What is the InChIKey of 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid?
The InChIKey is RNBBSHPIOYMYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-6-3-4-8-9(10(13)12(15)16)5-14-11(8)7(6)2/h3-4,9-10,14H,5,13H2,1-2H3,(H,15,16).
What are the key properties of 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid?
2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid has a molecular weight of 220.27 g/mol, XLogP of 1.22, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(6,7-dimethyl-2,3-dihydro-1H-indol-3-yl)acetic acid is sourced from PubChem (CID 83860435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).