C10H16N4O2 — CID 83864193
1-methyl-3-(4-methylpiperazin-1-yl)pyrazole-5-carboxylic acid (PubChem CID 83864193) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-methyl-3-(4-methylpiperazin-1-yl)pyrazole-5-carboxylic acid.
| Compound Name | 1-methyl-3-(4-methylpiperazin-1-yl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 83864193 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-methyl-3-(4-methylpiperazin-1-yl)pyrazole-5-carboxylic acid |
| SMILES | CN1CCN(c2cc(C(=O)O)n(C)n2)CC1 |
| InChI | InChI=1S/C10H16N4O2/c1-12-3-5-14(6-4-12)9-7-8(10(15)16)13(2)11-9/h7H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | KXSOTSUDSAKPME-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |