C7H10BrN5 — CID 83867234
5-bromo-4-N-cyclopropylpyrimidine-2,4,6-triamine (PubChem CID 83867234) has the molecular formula C7H10BrN5 and a molecular weight of 244.10 g/mol. Its IUPAC name is 5-bromo-4-N-cyclopropylpyrimidine-2,4,6-triamine.
| Compound Name | 5-bromo-4-N-cyclopropylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 83867234 |
| Molecular Formula | C7H10BrN5 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 5-bromo-4-N-cyclopropylpyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(N)c(Br)c(NC2CC2)n1 |
| InChI | InChI=1S/C7H10BrN5/c8-4-5(9)12-7(10)13-6(4)11-3-1-2-3/h3H,1-2H2,(H5,9,10,11,12,13) |
| InChIKey | JIVQOYJDTRUTBS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |