C9H12N2S2 — CID 83871875
4-methylsulfanyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione (PubChem CID 83871875) has the molecular formula C9H12N2S2 and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-methylsulfanyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione.
| Compound Name | 4-methylsulfanyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 83871875 |
| Molecular Formula | C9H12N2S2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-methylsulfanyl-5,6,7,8-tetrahydro-1H-quinazoline-2-thione |
| SMILES | CSc1nc(=S)[nH]c2c1CCCC2 |
| InChI | InChI=1S/C9H12N2S2/c1-13-8-6-4-2-3-5-7(6)10-9(12)11-8/h2-5H2,1H3,(H,10,11,12) |
| InChIKey | OADWLPOVEJURBG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|