About 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine
3-tert-butylimidazo[1,2-a]pyrimidin-6-amine (PubChem CID 83877585) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine |
| PubChem CID | 83877585 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine |
| SMILES | CC(C)(C)c1cnc2ncc(N)cn12 |
| InChI | InChI=1S/C10H14N4/c1-10(2,3)8-5-13-9-12-4-7(11)6-14(8)9/h4-6H,11H2,1-3H3 |
| InChIKey | OUCKUIMANRIYBM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine?
The IUPAC name of 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine (CID 83877585) is 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine.
What is the SMILES notation for 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine?
The canonical SMILES for 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine is CC(C)(C)c1cnc2ncc(N)cn12.
What is the InChIKey of 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine?
The InChIKey is OUCKUIMANRIYBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-10(2,3)8-5-13-9-12-4-7(11)6-14(8)9/h4-6H,11H2,1-3H3.
What are the key properties of 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine?
3-tert-butylimidazo[1,2-a]pyrimidin-6-amine has a molecular weight of 190.25 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butylimidazo[1,2-a]pyrimidin-6-amine is sourced from PubChem (CID 83877585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).