C10H14ClNO2 — CID 83886888
6-(2-amino-1-hydroxyethyl)-4-chloro-2,3-dimethylphenol (PubChem CID 83886888) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 6-(2-amino-1-hydroxyethyl)-4-chloro-2,3-dimethylphenol.
| Compound Name | 6-(2-amino-1-hydroxyethyl)-4-chloro-2,3-dimethylphenol |
|---|---|
| PubChem CID | 83886888 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 6-(2-amino-1-hydroxyethyl)-4-chloro-2,3-dimethylphenol |
| SMILES | Cc1c(Cl)cc(C(O)CN)c(O)c1C |
| InChI | InChI=1S/C10H14ClNO2/c1-5-6(2)10(14)7(3-8(5)11)9(13)4-12/h3,9,13-14H,4,12H2,1-2H3 |
| InChIKey | NIKBLOQUBUMNDA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |