C12H19NO — CID 117284183
2-amino-1-(2,3,4,5-tetramethylphenyl)ethanol (PubChem CID 117284183) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-amino-1-(2,3,4,5-tetramethylphenyl)ethanol.
| Compound Name | 2-amino-1-(2,3,4,5-tetramethylphenyl)ethanol |
|---|---|
| PubChem CID | 117284183 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-amino-1-(2,3,4,5-tetramethylphenyl)ethanol |
| SMILES | Cc1cc(C(O)CN)c(C)c(C)c1C |
| InChI | InChI=1S/C12H19NO/c1-7-5-11(12(14)6-13)10(4)9(3)8(7)2/h5,12,14H,6,13H2,1-4H3 |
| InChIKey | VWSZCRFPOJQHMU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |