C10H14N6 — CID 83888234
7-(piperazin-1-ylmethyl)imidazo[1,2-b][1,2,4]triazine (PubChem CID 83888234) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 7-(piperazin-1-ylmethyl)imidazo[1,2-b][1,2,4]triazine.
| Compound Name | 7-(piperazin-1-ylmethyl)imidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 83888234 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 7-(piperazin-1-ylmethyl)imidazo[1,2-b][1,2,4]triazine |
| SMILES | c1cnn2c(CN3CCNCC3)cnc2n1 |
| InChI | InChI=1S/C10H14N6/c1-2-14-16-9(7-13-10(16)12-1)8-15-5-3-11-4-6-15/h1-2,7,11H,3-6,8H2 |
| InChIKey | PGRYBXGCIAJHJW-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |