About 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid
3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid (PubChem CID 83894547) has the molecular formula C7H3ClN2O3S
and a molecular weight of 230.63 g/mol. Its IUPAC name is 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid.
Analyze 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid?
The IUPAC name of 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid (CID 83894547) is 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid.
What is the SMILES notation for 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid?
The canonical SMILES for 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid is O=C(O)c1sc2nccc(=O)n2c1Cl.
What is the InChIKey of 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid?
The InChIKey is LKHAMMIWJDLJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN2O3S/c8-5-4(6(12)13)14-7-9-2-1-3(11)10(5)7/h1-2H,(H,12,13).
What are the key properties of 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid?
3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid has a molecular weight of 230.63 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid is sourced from PubChem (CID 83894547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).