C11H14BrN3 — CID 83902890
3-bromo-N,N-diethylimidazo[1,2-a]pyridin-7-amine (PubChem CID 83902890) has the molecular formula C11H14BrN3 and a molecular weight of 268.16 g/mol. Its IUPAC name is 3-bromo-N,N-diethylimidazo[1,2-a]pyridin-7-amine.
| Compound Name | 3-bromo-N,N-diethylimidazo[1,2-a]pyridin-7-amine |
|---|---|
| PubChem CID | 83902890 |
| Molecular Formula | C11H14BrN3 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 3-bromo-N,N-diethylimidazo[1,2-a]pyridin-7-amine |
| SMILES | CCN(CC)c1ccn2c(Br)cnc2c1 |
| InChI | InChI=1S/C11H14BrN3/c1-3-14(4-2)9-5-6-15-10(12)8-13-11(15)7-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | GSLWWHYIOYQUIJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |