4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid

C10H14N2O3 — CID 83909535

IUPAC4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid
SMILESCc1nn(C)c2c1C(O)(C(=O)O)CCC2
InChIInChI=1S/C10H14N2O3/c1-6-8-7(12(2)11-6)4-3-5-10(8,15)9(13)14/h15H,3-5H2,1-2H3,(H,13,14)
InChIKeyBNCQVXKUGHUUDG-UHFFFAOYSA-N
MW210.23 g/mol
LogP0.34
Rot. Bonds1

About 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid

4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid (PubChem CID 83909535) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid.

Molecular Properties

Compound Name4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid
PubChem CID83909535
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid
SMILESCc1nn(C)c2c1C(O)(C(=O)O)CCC2
InChIInChI=1S/C10H14N2O3/c1-6-8-7(12(2)11-6)4-3-5-10(8,15)9(13)14/h15H,3-5H2,1-2H3,(H,13,14)
InChIKeyBNCQVXKUGHUUDG-UHFFFAOYSA-N
XLogP0.34
TPSA75.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 50.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The IUPAC name of 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid (CID 83909535) is 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid.
What is the SMILES notation for 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The canonical SMILES for 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid is Cc1nn(C)c2c1C(O)(C(=O)O)CCC2.
What is the InChIKey of 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The InChIKey is BNCQVXKUGHUUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-6-8-7(12(2)11-6)4-3-5-10(8,15)9(13)14/h15H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid has a molecular weight of 210.23 g/mol, XLogP of 0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid is sourced from PubChem (CID 83909535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).