C6H6N4O — CID 83914040
2-isocyanato-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 83914040) has the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. Its IUPAC name is 2-isocyanato-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 2-isocyanato-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 83914040 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2-isocyanato-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | O=C=Nc1nc2n(n1)CCC2 |
| InChI | InChI=1S/C6H6N4O/c11-4-7-6-8-5-2-1-3-10(5)9-6/h1-3H2 |
| InChIKey | UIRIZIPEONRDCS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|