C9H15NOS — CID 83915233
2,3,4a,5,6,8,9,9a-octahydro-1H-thiepino[4,5-b]pyridin-4-one (PubChem CID 83915233) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 2,3,4a,5,6,8,9,9a-octahydro-1H-thiepino[4,5-b]pyridin-4-one.
| Compound Name | 2,3,4a,5,6,8,9,9a-octahydro-1H-thiepino[4,5-b]pyridin-4-one |
|---|---|
| PubChem CID | 83915233 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2,3,4a,5,6,8,9,9a-octahydro-1H-thiepino[4,5-b]pyridin-4-one |
| SMILES | O=C1CCNC2CCSCCC12 |
| InChI | InChI=1S/C9H15NOS/c11-9-1-4-10-8-3-6-12-5-2-7(8)9/h7-8,10H,1-6H2 |
| InChIKey | AKUCBSODLGJJAC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |