C15H22O — CID 83928064
2-[2-(2,4-dimethylphenyl)propyl]-3-ethyloxirane (PubChem CID 83928064) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)propyl]-3-ethyloxirane.
| Compound Name | 2-[2-(2,4-dimethylphenyl)propyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83928064 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)propyl]-3-ethyloxirane |
| SMILES | CCC1OC1CC(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H22O/c1-5-14-15(16-14)9-12(4)13-7-6-10(2)8-11(13)3/h6-8,12,14-15H,5,9H2,1-4H3 |
| InChIKey | IVXBAUINMPQKFU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|