C18H26O2 — CID 83942853
1,4-diethoxy-2-(3-methylhept-4-yn-2-yl)benzene (PubChem CID 83942853) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1,4-diethoxy-2-(3-methylhept-4-yn-2-yl)benzene.
| Compound Name | 1,4-diethoxy-2-(3-methylhept-4-yn-2-yl)benzene |
|---|---|
| PubChem CID | 83942853 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1,4-diethoxy-2-(3-methylhept-4-yn-2-yl)benzene |
| SMILES | CCC#CC(C)C(C)c1cc(OCC)ccc1OCC |
| InChI | InChI=1S/C18H26O2/c1-6-9-10-14(4)15(5)17-13-16(19-7-2)11-12-18(17)20-8-3/h11-15H,6-8H2,1-5H3 |
| InChIKey | UDJYGIRXYRAQBI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|